| Literature DB >> 30050023 |
Stefano Dugheri1, Alessandro Bonari2, Matteo Gentili3, Giovanni Cappelli4, Ilenia Pompilio5, Costanza Bossi6, Giulio Arcangeli7, Marcello Campagna8, Nicola Mucci9.
Abstract
High-throughput screening of samples is the strategy of choice to detect occupational exposure biomarkers, yet it requires a user-friendly apparatus that gives relatively prompt results while ensuring high degrees of selectivity, precision, accuracy and automation, particularly in the preparation process. Miniaturization has attracted much attention in analytical chemistry and has driven solvent and sample savings as easier automation, the latter thanks to the introduction on the market of the three axis autosampler. In light of the above, this contribution describes a novel user-friendly solid-phase microextraction (SPME) off- and on-line platform coupled with gas chromatography and triple quadrupole-mass spectrometry to determine urinary metabolites of polycyclic aromatic hydrocarbons 1- and 2-hydroxy-naphthalene, 9-hydroxy-phenanthrene, 1-hydroxy-pyrene, 3- and 9-hydroxy-benzoantracene, and 3-hydroxy-benzo[a]pyrene. In this new procedure, chromatography's sensitivity is combined with the user-friendliness of N-tert-butyldimethylsilyl-N-methyltrifluoroacetamide on-fiber SPME derivatization using direct immersion sampling; moreover, specific isotope-labelled internal standards provide quantitative accuracy. The detection limits for the seven OH-PAHs ranged from 0.25 to 4.52 ng/L. Intra-(from 2.5 to 3.0%) and inter-session (from 2.4 to 3.9%) repeatability was also evaluated. This method serves to identify suitable risk-control strategies for occupational hygiene conservation programs.Entities:
Keywords: MTBSTFA; OH-PAHs; SPME; gas-chromatography
Mesh:
Substances:
Year: 2018 PMID: 30050023 PMCID: PMC6222761 DOI: 10.3390/molecules23081869
Source DB: PubMed Journal: Molecules ISSN: 1420-3049 Impact factor: 4.411
Physical properties and partition coefficients of OH-PAHs evaluated using SPARC. (M.W. = molecular weight; Teb = boiling point; Dwater = diffusion coefficient of the analyte in water; KH = Henry’s constant; Kow = octanol-water partition coefficient; Pvap = vapour pressure).
| SMILES strings | M.W. (g/mol) | Teb (°C) | Dwater (cm2/s) | KH (atm/(mol/m3)) | KOW (Log) | Pvap (log(atm)) |
|---|---|---|---|---|---|---|
| OC1=CC=CC2=CC=CC=C21 | 144 | 269.7 | 8.08 × 10−6 | 8.39 × 10−8 | 3.04 | −6.0 |
| OC1=CC2=CC=CC=C2C=C1 | 144 | 269.8 | 8.08 × 10−6 | 9.10 × 10−8 | 3.11 | −6.14 |
| OC1=CC2=C(C3=C1C=CC=C3)C=CC=C2 | 194 | 378.9 | 6.92 × 10−6 | 6.93 × 10−9 | 4.49 | −8.67 |
| OC1=CC=C(C=C2)C3=C1C=CC4=CC=CC2=C34 | 218 | 454.6 | 6.41 × 10−6 | 6.37 × 10−9 | 5.01 | −8.9 |
| OC(C=C1)=CC2=C1C3=CC4=CC=CC=C4C=C3C=C2 | 244 | 537.2 | 6.15 × 10−6 | 3.24 × 10−10 | 5.71 | −11.86 |
| OC1=CC=C2C(C=C(C=CC3=C4C=CC=C3)C4=C2)=C1 | 244 | 537.2 | 6.15 × 10−6 | 3.21 × 10−10 | 5.71 | −11.86 |
| OC1=CC=C(C=C2)C3=C1C=CC4=CC5=CC=CC=C5C2=C43 | 268 | 564.5 | 5.74 × 10−6 | 4.56 × 10−10 | 6.28 | -11.81 |
Figure 1Derivatization of hydroxylated polycyclic aromatic hydrocarbons (OH-PAHs) with N-tert-butyldimethylsilyl-N-methyltrifluoroacetamide (MTBSTFA).
Figure 2Comparison between solid-phase microextraction fast fit fiber assemblies (SPME-FFA) Multi Off-Line Sampler (A) and SPME on-line (B) for the analysis of 60 urinary OH-PAHs samples.
Limits of detection (LOD), limit of quantification (LOQ), accuracy and precision for each OH-PAH measured in urine samples.
| Response factor Plot and Limit of Detection and Quantification | ||||||||
|---|---|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
| ||
| Least-squares linear regression parameters | m | 1.0924 | 1.0922 | 1.1125 | 1.1126 | 1.1244 | 1.1240 | 1.1245 |
| b | 0.1893 | 0.2204 | 0.0769 | 0.0828 | 0.0455 | 0.0453 | 0.0368 | |
| Coefficient of Correlation | 0.99 | 0.99 | 1.00 | 0.99 | 0.99 | 1.00 | 1.00 | |
| LOD (ng L−1) | 4.52 | 4,03 | 2.53 | 1.89 | 0.31 | 0.33 | 0.25 | |
| LOQ (ng L−1) | 14.91 | 13.20 | 8.34 | 6.23 | 1.02 | 1.08 | 0.82 | |
|
| ||||||||
| Within-session accuracy | 10.0 | 9.3 | 10.3 | 9.8 | 10.5 | 10.2 | 10.7 | |
| Within-session repeatability | 2.7 | 2.7 | 3.0 | 2.7 | 2.5 | 2.6 | 2.5 | |
| Inter-session repeatability | 3.0 | 3.0 | 3.6 | 3.9 | 3.4 | 2.4 | 3.4 | |
OH-PAHs in human urine of smokers and non-smokers. (SD = standard deviation).
| Non-Smokers | Smokers | |
|---|---|---|
| Average (ng/L) ± SD (min-max Value) | Average (ng/L) ± SD (min-max Value) | |
| 1-OH-Nap | 1040.6 ± 340.7 (150.3–1500.2) | 2966.6 ± 904.3 (240.1–3500.6) |
| 2-OH-Nap | 1879.2 ± 402.4 (201.6–2001.3) | 4297.5 ± 1151.2 (2898.3–8214.4) |
| 9-OH-Phen | <LOD ± 0.54 (<LOD–3.2) | <LOD ± 0.66 (<LOD–3.6) |
| 1-OH-P | 59.3 ± 27.4 (25.1–166.7) | 291.4 ± 89.3 (178.0–647.2) |
| 3-OH-B[a]A | 0.43 ± 0.21 (<LOD–1.2) | 0.60 ± 0.23 (<LOD–1.6) |
| 9-OH-B[a]A | <LOD ± 0.25 (<LOD–1.41) | 1.44 ± 0.59 (<LOD–2.3) |
| 3-OH-B[a]P | <LOD ± 0.17 (<LOD–0.91) | 0.98 ± 0.14 (<LOD–1.32) |
Figure 3The SPME Multi Off-Line Sampler.
GC/QpQ-MS method parameters.
|
| |
| Injection | 300 °C, 20:1 split mode. Liner 0.75 mm i.d. |
| Oven | 80 °C (1 min) increased to 20 °C/min end to 320 °C (5 min) |
| Column flow | Helium (99.999%) at a flow rate of 1.2 mL/min |
| Retention time | 1-OH-Nap (8.90 min); 2-OH-Nap (9.05 min); 9-OH-Phen (11.96 min); 1-OH-P (13.38 min); 3-OH-B[a]A (14.93 min); 9-OH-B[a]A (14.93 min); 3-OH-B[a]P (17.72 min) |
| GC interface | 280 °C |
|
| |
| Mode | EI |
| Filament | Electron energy, 70 eV. Filament current 50 μA |
| Source | Temperature, 200 °C. Pressure, 8 Torr. |
| Collision gas | CID gas, Argon. CID gas pressure, 2.00 mTorr |
| Collision energy | 1-OH-Nap 15 eV; 2-OH-Nap 15 eV; 9-OH-Phen 15 eV; 1-OH-P 15 eV; 3-OH-B[a]A 15 eV; OH-9-B[a]A 15 eV; 3-OH-B[a]P 10 eV. |
|
| |
| 1-OH-Nap | Fragment Q1 > Q3 Quantification |
| 2-OH-Nap | Q1 > Q3 258.5→201.2 201.4→185.0 |
| 9-OH-Phen | Q1 > Q3 308.5→251.2 251.4→235.0 |
| 1-OH-P | Q1 > Q3 332.5→275.0 275.4→259.0 |
| 3-OH-B[a]A | Q1 > Q3 358.5→301.1 301.5→285.0 |
| 9-OH-B[a]A | Q1 > Q3 358.5→301.1 301.5→285.0 |
| 3-OH-B[a]P | Q1 > Q3 382.6→325.2 382.6→309.6 |
Figure 4Chromatogram of OH-PAHs by gas chromatography (GC)/triple quadrupole-mass spectrometry (QpQ-MS) in spiked artificial urine. A = 1-OH-Nap (200 ng/L); B = 2-OH-Nap (600 ng/L); C = 9-OH-Phen (50 ng/L); D = 1-OH-P (400 ng/L); E = 3-OH-B[a]A (1 ng/L); F = 9-OH-B[a]A (1 ng/L); G = 3-OH-B[p]A (5 ng/L).