| Literature DB >> 16802041 |
Yun-Sheng Ma1, You Song, Wen-Xin Du, Yi-Zhi Li, Li-Min Zheng.
Abstract
This paper reports the syntheses and structures of three new copper phosphonates based on 2-pyridylphosphonate, namely, Cu(C(5)H(4)NPO(3)H)2 (1), Cu3(OH)2(C(5)H(4)NPO(3))2.2H2O (2) and Cu(C(5)H(4)NPO(3)) (3). Compound 1 has a discrete dimeric structure in which the {CuO(4)N} square pyramids are linked by the {CPO(3)} tetrahedra through corner-sharing. The dimers are further connected into a chain through hydrogen bonds. In compound 2, edge-sharing {Cu(1)O(4)N} square pyramids and {Cu(2)O(4)} planes are found to form an infinite chain with composition {Cu(3)(mu-OH)(2)(mu-O)(4)}. Neighboring chains are linked by the phosphonate groups of the 2-pyridylphosphonate ligands, resulting in inorganic layers containing 4-, 8- and 12-membered rings. The pyridyl groups and the lattice water molecules occupy the inter-layer space. In compound 3, the {Cu(1)O(4)} and {Cu(2)O(2)N(2)} planes are each corner-shared with the {CPO(3)} tetrahedra, forming an inorganic layer containing 8- and 16-membered rings. The pyridyl groups reside between the layers. Crystal data for 1: space group P(-)1, a = 8.4045(19), b = 8.751(2), c = 10.632(2) A, alpha = 66.673(4), beta = 72.566(4), gamma = 70.690(4) degrees , V = 664.7(2) A(3), Z = 2. Crystal data for 2: space group P2(1)/c, a = 7.9544(17), b = 21.579(4), c = 5.0243(10) A, beta = 105.332(3) degrees , V = 831.7(3) A(3), Z = 2. Crystal data for 3: space group P2(1)/c, a = 4.7793(11), b = 15.319(3), c = 8.6022(19) A, beta = 97.156(4) degrees , V = 624.9(2) A(3), Z = 4. Magnetic measurements reveal that dominant antiferromagnetic interactions are propagated between the copper centers in compounds 1-3. For 3, spin canting is observed with a ferromagnetic transition occurring at 9 K.Entities:
Year: 2006 PMID: 16802041 DOI: 10.1039/b517311f
Source DB: PubMed Journal: Dalton Trans ISSN: 1477-9226 Impact factor: 4.390