Reactivity at the beta-diketiminate ligand Nacnac- on titanium(IV) (Nacnac- = [Ar]NC(CH3)CHC(CH3)N[Ar], Ar = 2,6-[CH(CH3)2]2C6H3). Diimine-alkoxo and bis-anilido ligands stemming from the Nacnac- skeleton.

The reaction of ketene OCCPh(2) with the four-coordinate titanium(IV) imide (L(1))Ti[double bond]NAr(OTf) (L(1)(-) = [Ar]NC(CH(3))CHC(CH(3))N[Ar], Ar = 2,6-[CH(CH(3))(2)](2)C(6)H(3)) affords the tripodal dimine-alkoxo complex (L(2))Ti[double bond]NAr(OTf) (L(2)(-) = [Ar]NC(CH(3))CHC(O)[double bond]CPh(2)C(CH(3))N[Ar]). Complex (L(2))Ti[double bond]NAr(OTf) forms from electrophilic attack of the beta-carbon of the ketene on the gamma-carbon of the Nacnac(-) NCC(gamma)CN ring. On the contrary, nucleophiles such as LiR (R(-) = Me, CH(2)(t)Bu, and CH(2)SiMe(3)) deprotonate cleanly in OEt(2) the methyl group of the beta-carbon on the former Nacnac(-) backbone to yield the etherate complex (L(3))Ti[double bond]NAr(OEt(2)), a complex that is now supported by a chelate bis-anilido ligand (L(3)(2)(-) = [Ar]NC(CH(3))CHC(CH(2))N[Ar]). In the absence of electrophiles or nucleophiles, the robust (L(1))Ti[double bond]NAr(OTf) template was found to form simple adducts with Lewis bases such as CN(t)Bu or NCCH(2)(2,4,6-Me(3)C(6)H(2)). Complexes (L(2))Ti[double bond]NAr(OTf), (L(3))Ti[double bond]NAr(OEt(2)), and the adducts (L(1))Ti[double bond]NAr(OTf)(XY) [XY = CN(t)Bu and NCCH(2)(2,4,6-Me(3)C(6)H(2))] were structurally characterized by single-crystal X-ray diffraction studies.