| Literature DB >> 11952365 |
Randy S Rarig1, Robert Lam, Peter Y Zavalij, J Katana Ngala, Robert L LaDuca, John E Greedan, Jon Zubieta.
Abstract
The reactions of a Cu(II) salt, MoO(3), and the appropriate bipyridine ligand yield a series of bimetallic oxides, [Cu(3,4'-bpy)MoO(4)] (1), [Cu(3,3'-bpy)(0.5)MoO(4)] (2), and [Cu(4,4'-bpy)(0.5)MoO(4)].1.5H(2)O (3.1.5H(2)O). The structures of 1-3 exhibit three-dimensional covalent frameworks, constructed from bimetallic oxide layers tethered by the dipodal organoimine ligands. However, the [CuMoO(4)] networks are quite distinct. For structure 1, the layer consists of corner-sharing [MoO(4)] tetrehedra and [CuN(2)O(3)] square pyramids, while the layer of 2 is constructed from [MoO(4)] tetrehedra and binuclear [Cu(2)O(6)N(2)] units of edge-sharing copper square pyramids. The oxide substructure of 3 consists of [MoO(4)] tetrahedra corner-sharing with tetranuclear clusters of edge-sharing [CuO(5)N] octahedra. Crystal data: C(10)H(8)N(2)O(4)CuMo (1), orthorhombic Pbca, a = 12.4823(6) A, b = 9.1699(4) A, c = 19.5647(9) A, V = 2239.4(1) A(3), Z = 8; C(5)H(4)NO(4)CuMo (2), triclinic P, a = 5.439(1) A, b = 6.814(1) A, c = 10.727(2) A, alpha = 73.909(4)(o), beta = 78.839(4)(o); gamma = 70.389(4)(o); V = 357.6(1) A(3), Z = 2; C(10)H(8)N(2)O(8)Cu(2)Mo(2).3H(2)O 3.1.5H(2)O, triclinic P, a = 7.4273(7) A, b = 9.2314(8) A, c = 13.880(1) A, alpha = 71.411(2)(o), beta = 88.528(2)(o), gamma = 73.650(2)(o), V = 863.4(1) A(3), Z = 2. The magnetic properties of 1-3 arise solely from the presence of the Cu(II) sites, but reflect the structural differences within the bimetallic oxide layers. Compound 1 exhibits magnetic behavior consistent with ferromagnetic chains which couple antiferromagnetically at low temperature. Compound 2 exhibits strong antiferromagnetic dimeric interactions, with the magnetic susceptibility data consistent with the Bleaney-Bowers equation. Similarly, the magnetic susceptibility of 3 is dominated by antiferromagnetic interactions, which may be modeled as a linear S = 1/2 Heisenberg tetramer.Entities:
Year: 2002 PMID: 11952365 DOI: 10.1021/ic0111536
Source DB: PubMed Journal: Inorg Chem ISSN: 0020-1669 Impact factor: 5.165