Novel trialkanolamine derivatives of tin of the type [N(CH2CMe2O)2(CH2)(n)OSnOR]m (m = 1, 2; n = 2, 3; R = t-Bu, 2,6-Me2C6H3) and related tri- and pentanuclear tin(IV) oxoclusters. Syntheses and molecular structures.

The syntheses of the novel alkanolamine N(CH(2)CMe(2)OH)(2)(CH(2)CH(2)CH(2)OH) (2), the novel aminotrialkoxides of tin of the type [N(CH(2)CMe(2)O)(2)(CH(2))(n)OSnOR](m) (3: m = 1, n = 2, R = t-Bu; 4: m = 2, n = 3, R = t-Bu; 5: m = n = 2, R = 2,6-Me(2)C(6)H(3); 6: m = 2, n = 3, R = 2,6-Me(2)C(6)H(3)) and the related trinuclear tin oxoclusters [(LSnOSnL)(LSnOR)] [L = N(CH(2)CMe(2)O)(2)(CH(2)CH(2)O), 7: R = t-Bu; 8: R = 2,6-Me(2)C(6)H(3)] and the pentanuclear tin oxocluster [LSnOSn(OH)(2)OSnL·2LSnOH], [9, L = N(CH(2)CMe(2)O)(2)(CH(2)CH(2)O)] are reported. The compounds are characterized by elemental analyses, multinuclear ((1)H, (13)C, (119)Sn, (1)H-(1)H cosy, (1)H-(13)C HSQC) NMR spectroscopy, electrospray ionization mass spectrometry, and single crystal X-ray diffraction analyses (3, 4·C(7)H(8), 5, 7, 8·0.5C(7)H(8), 9·6H(2)O).