Synthesis and reactivity of cationic niobium and tantalum methyl complexes supported by imido and β-diketiminato ligands.

The synthesis and reactivity of the cationic niobium and tantalum monomethyl complexes [(BDI)MeM(N(t)Bu)][X] (BDI = [Ar]NC(CH(3))CHC(CH(3))N[Ar], Ar = 2,6-(i)Pr(2)C(6)H(3); M = Nb, Ta; X = MeB(C(6)F(5))(3), B(C(6)F(5))(4)] was investigated. The cationic alkyl complexes failed to irreversibly bind CO but formed phosphine-trapped acyl complexes [(BDI)(R(3)PC(O)Me)M(N(t)Bu)][B(C(6)F(5))(4)] (R = Et, Cy) in the presence of a combination of trialkylphosphines and CO. Treatment of the monoalkyl cationic Nb complex with XylNC (Xyl = 2,6-Me(2)-C(6)H(3)) resulted in irreversible formation of the iminoacyl complex [(BDI)(XylN[double bond, length as m-dash]C(Me))Nb(N(t)Bu)][B(C(6)F(5))(4)], which did not bind phosphines but would add a methide group to the iminoacyl carbon to provide the known ketimine complex (BDI)(XylNCMe(2))Nb(N(t)Bu). Further stoichiometric chemistry explored i) migratory insertion reactions to form new alkoxide, amidinate, and ketimide complexes; ii) protonolysis reactions with Ph(3)SiOH to form thermally robust cationic siloxide complexes; and iii) catalytic high-density polyethylene formation mediated by the cationic Nb methyl complex. This journal is © The Royal Society of Chemistry 2011