| Literature DB >> 15357880 |
Anuradha Vivekanandan Giri1, Sharmila Anishetty, Pennathur Gautam.
Abstract
BACKGROUND: Proteins having similar functions from different sources can be identified by the occurrence in their sequences, a conserved cluster of amino acids referred to as pattern, motif, signature or fingerprint. The wide usage of protein sequence analysis in par with the growth of databases signifies the importance of using patterns or signatures to retrieve out related sequences. Blue copper proteins are found in the electron transport chain of prokaryotes and eukaryotes. The signatures already existing in the databases like the type 1 copper blue, multiple copper oxidase, cyt b/b6, photosystem 1 psaA&B, psaG&K, and reiske iron sulphur protein are not specified signatures for blue copper proteins as the name itself suggests. Most profile and motif databases strive to classify protein sequences into a broad spectrum of protein families. This work describes the signatures designed based on the copper metal binding motifs in blue copper proteins. The common feature in all blue copper proteins is a trigonal planar arrangement of two nitrogen ligands [each from histidine] and one sulphur containing thiolate ligand [from cysteine], with strong interactions between the copper center and these ligands.Entities:
Mesh:
Substances:
Year: 2004 PMID: 15357880 PMCID: PMC517927 DOI: 10.1186/1471-2105-5-127
Source DB: PubMed Journal: BMC Bioinformatics ISSN: 1471-2105 Impact factor: 3.169
Figure 1a) Rusticyanin bound to the copper atom as indicated by the blue colored ball. b) Copper binding active site of rusticyanin showing the four active site residues: Histidine at 85th position, Histidine at 143rd position, Cysteine at 138th position and Methionine at 148th position
Amino acids bound to the copper atom of the blue copper proteins of eukaryotic origin. Plastocyanins are also found in prokaryotes. The * indicates that crystal structures are as yet not available.
| 1 | PLANTACYANIN PDB: 1F56 | 34 HIS | 74CYS | 79 HIS | 84 MET |
| 2 | PLASTOCYANIN PDB: 1AG6 | 37 HIS | 84 CYS | 87 HIS | 92 MET |
| 3 | CUCUMBER BASIC PROTEIN PDB: 2CBP | 39 HIS | 79 CYS | 84 HIS | 89 MET |
| 4 | STELLACYANIN1JER | 46 HIS | 89 CYS | 94 HIS | 99 GLN |
| 5 | DICYANIN | * | * | * | * |
| 6 | UMECYANIN P42849 | 44 HIS | 85 CYS | 90 HIS | 95 GLN |
| 7 | UCLACYANIN | * | * | * | * |
| 8 | CUSACYANIN P00303 | 39 HIS | 79 CYS | 84 HIS | 89 MET |
Amino acids bound to the copper atom of the blue copper proteins of prokaryotic origin.
| 1 | RUSTICYANIN PDB: 1A8Z | 85 HIS | 138 CYS | 143 HIS | 148 MET |
| 2 | SULFOCYANIN Q53765 | 110 HIS | 171 CYS | 176 HIS | 181 MET |
| 3 | HALOCYANIN P39442 | 110 HIS | 148 CYS | 151 HIS | 156 MET |
| 4 | AZURIN PDB: 1DYZ | 46 HIS | 112 CYS | 117 HIS | 121 MET |
| 5 | PSEUDOAZURIN PDB: 1ADW | 40 HIS | 78 CYS | 81 HIS | 86 MET |
| 6 | AURACYANIN PDB: 1QHQ | 57 HIS | 122 CYS | 127 HIS | 132 GLN |
| 7 | AMICYANIN PDB: 1AAC | 53 HIS | 92 CYS | 95 HIS | 98 MET |
| 8 | NITRITE REDUCTASE PDB: 1AS6 | 95 HIS | 136 CYS | 145 HIS | 150 MET |
Number of retrieved protein sequences from different databases on a keyword search
| 1 | PLANTACYANIN | 18 | 1 | 4 | 10 | 9 | 2 |
| 2 | PLASTOCYANIN | 988 | 41 | 22 | 463 | 397 | 40 |
| 3 | CUCUMBER BASIC PROTEIN | 6 | 1 | * | * | 4 | 1 |
| 4 | STELLACYANIN | 26 | 3 | 3 | 33 | 12 | 2 |
| 5 | UMECYANIN | 4 | 1 | * | 1 | 1 | * |
| 6 | UCLACYANIN | 23 | 1 | 5 | 9 | 9 | * |
| 7 | CUSACYANIN | 2 | 1 | * | 1 | 1 | 1 |
| 8 | DICYANIN | 1 | * | 1 | 1 | 1 | * |
| 9 | RUSTICYANIN | 52 | 2 | 8 | 22 | 25 | 7 |
| 10 | SULFOCYANIN | 14 | 1 | 5 | 6 | 6 | * |
| 11 | HALOCYANIN | 15 | 1 | 4 | 7 | 5 | * |
| 12 | AZURIN | 320 | 22 | 23 | 202 | 66 | 49 |
| 13 | PSEUDOAZURIN | 68 | 6 | 4 | 25 | 22 | 16 |
| 14 | AURACYANIN | 10 | 1 | 2 | 5 | 3 | 2 |
| 15 | AMICYANIN | 105 | 3 | 3 | 34 | 34 | 10 |
| 16 | NITRITE REDUCTASE | 1744 | 37 | 735 | 1027 | 1017 | 69 |
Already existing signatures present in the Prosite motif database for the blue copper proteins
| 1 | PLANTACYANIN | PDOC00174 TYPE-1 COPPER BLUE | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 2 | PLASTOCYANIN | PDOC00171 Cyt b/b6 | 1. PS00192 – Cyt b Heme | [DENQ]-x(3)-[G]-[FYMWQ]-x-[LIVMF]-[R]-x(2)-H |
| 2. PS00193 – Cyt b QO | [P]-[DE]-[W]-[FY]-[LFY](2) | |||
| PDOC00347 Photosystem 1 psaA and psaB | 1. PS00419 – Photosystem 1 PSAAB | CDGPGRGGTC | ||
| PDOC00786 Photosystem 1 psaG and psaK | 1. PS01026 – Photosystem 1 PSAGK | [GT]-[F]-x-[LIVM]-x-[DEA]-x(2)-[GA]-x-[GTA]-[STA]-x-[GH]-x-[LIVM]-[GA] | ||
| PDOC00177 Reiske-Iron Sulfur | 1. PS00199 – Reiske 1 | [C]-[TK]-[H]-[L]-[G]-[C]-[LIVST] | ||
| 2. PS00200 – Reiske 11 | [C]-[P]-[C]-[H]-x-[GSA] | |||
| 3 | CUCUMBER BASIC PROTEIN | * | * | * |
| 4 | STELLACYANIN | PDOC00174 Type 1 Blue Copper | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 5 | UMECYANIN | PDOC00174 Type 1 Blue Copper | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 6 | UCLACYANIN | * | * | * |
| 7 | CUSACYANIN | PDOC00174 Type 1 Blue Copper | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 8 | DICYANIN | * | * | * |
| 9 | RUSTICYANIN | PDOC00076 Multiple Copper Oxidase | 1. PS00079 – Copper Oxidase | [G]-x-[FYW]-x(LIVMFYW)-x-[CST]-x(8)-[G]-[LM]-x(3)-[LIVMFYW] |
| 2. PS00080 – Multiple Copper Oxidase | [H]-[C]-[H]-x(3)-[H]-x(3)-[AG]-[LM] | |||
| 10 | SULFOCYANIN | * | * | * |
| 11 | HALOCYANIN | PDOC00174 Type 1 Blue Copper | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 12 | AZURIN | PDOC00174 Type 1 Blue Copper | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 13 | PSEUDOAZURIN | * | * | * |
| 14 | AURACYANIN | PDOC00174 Type 1 Blue Copper | 1. PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
| 15 | AMICYANIN | * | * | * |
| 16 | NITRITE REDUCTASE | PDOC00174 Type 1 Blue Copper | PS00196 | [GA]-x(0,2)-[YSA]-x(0,1)-[VFY]-x-[C]-x(1,2)-[PG]-x(0,1)-[H]-x(2,4)-[MQ] |
Number of protein sequences retrieved from the PIR nREF database for the already existing signatures for the blue copper proteins
| PS00079 | 779 |
| PS00080 | 366 |
| PS00192 | 18593 |
| PS00193 | 13818 |
| PS00196 | 589 |
| PS00199 | 158 |
| PS00200 | 284 |
| PS00419 | 348 |
| PS01026 | 3 |
Newly designed protein signatures/peptides for the different blue copper proteins. The number of protein sequences retrieved from the PIR nREF database for each of the newly designed signatures.
| 1 | PLANTACYANIN | [F]-[I]-[C]-[NST]-[F]-[PG]-x-[H]-[C] | 10 | NO |
| 2 | PLASTOCYANIN [eukaryotic source] | [C]-x-[P]-[H]-x-[GS]-[A]-[GN]-[M] | 80 | 1 |
| 3 | PLASTOCYANIN [prokaryotic source] | [Y]-[C]-x-[P]-[H]-[R]-[G]-[A]-[G]-[M]-[V]-[G] | 21 | NO |
| 4 | PLASTOCYANIN [prokaryotic source] | PHRGAGMVG | 21 | NO |
| 5 | STELLACYANIN | [H]-[C]-x-[NL]-[G]-[MQ]-[K]-[LV]-x-[VI]-[NRQ]-[V] | 7 | 1 |
| 6 | UCLACYANIN | [P]-[G]-x-[R]-[Y]-[F]-[I]-[C]-[G] | 3 | NO |
| 7 | UCLACYANIN | RYFICG | 11 | NO |
| 8 | RUSTICYANIN | [G]-[M]-[YF]-[G]-[K]-[I]-[V]-[V] | 8 | NO |
| 9 | SULFOCYANIN | [C]-[G]-[I]-[AL]-[G]-[H]-[A]-[VAQ]-[SA]-[G]-[M]-[W] | 5 | 1 |
| 10 | SULFOCYANIN | FNFNGTS | 5 | 1 |
| 11 | AMICYANIN | [AP]-[G]-[SAT]-[FVY]-[D]-[YF]-[FHIY]-[C]-[RT]-x-[H]-[P] | 10 | 1 |
| 12 | HALOCYANIN | [C]-[TN]-[P]-[H]-x-[AT]-x-[G]-[M]-x-[G]-[A] | 2 | NO |
| 13 | PSEUDOAZURIN | [K]-[C]-[TA]-[P]-[H]-x-[GAM]-[M]-[GS]-[M] | 18 | NO |
| 14 | AZURIN | [D]-x-[R]-[V]-[LI]-[A]-[HYF]-[T]-x-[VIL]-[VIL]-[G]-[GAS]-[G] | 54 | NO |
| 15 | NITRITE REDUCTASE | [P]-[ST]-[HY]-[VIGA]-[VL]-[FM]-[N]-[G] | 235 | NO |