6-amino-3-bromo-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one-acetone-water (1/1/1): a fluorinated 2'-deoxyguanosine analogue with the sugar conformation of a ribonucleoside.

In the title compound, C(10)H(11)BrFN(5)O(4).C(3)H(6)O.H(2)O, the N-glycosylic bond torsion angle, chi, is anti [-108.0 (4) degrees ]. The sugar pucker is N-type [C2'-exo, (2)E with P = 346.5 (4) degrees and tau(m) = 34.5 (2) degrees ], and the conformation around the C-C bond linking the CH(2) group and the furan ring is -sc [torsion angle gamma = -70.0 (4) degrees ].