A 1:1 molecular complex of bis(4-aminophenyl) disulfide and 4-aminothiophenol.

The centrosymmetric crystal structure of the title complex, C(12)H(12)N(2)S(2).C(6)H(7)NS, is built up of dimers of the constituent molecules and stabilized by a herring-bone geometry between the phenyl rings. The structure reveals an N-H...N-H...N-H...S co-operative hydrogen-bonded chain, and C-H...S and N-H...pi hydrogen bonds. The S-H group forms an uncommon S-H...pi interaction.