Template Synthesis and Reactions of Tricarbonylmolybdenum Phosphadithiamacrocycle Complexes.

Treatment of [Me(4)N](2)[PhP(CH(2)CH(2)S)(2)] with [Mo(CO)(3)(NCMe)(3)] affords the reactive intermediate [Me(4)N](2)[Mo(CO)(3){PhP(CH(2)CH(2)S)(2)}] (1), which undergoes oxidation to afford [Mo{PhP(CH(2)CH(2)S)(2)}(2)] (2). Reaction of 1 with a variety of dichloroalkanes produces [Mo(CO)(3){c-PhP(CH(2)CH(2)S)(2)X}] (X = CH(2)CH(2), CH(2)CH(2)CH(2), CH(2)CHMe or CH(2)CH(OH)CH(2)). The structure of [Mo(CO)(3){c-PhP(CH(2)CH(2)S)(2)CH(2)CH(2)}] (3) has been established by X-ray crystallography and consists of a Mo(CO)(3) fragment facially coordinated by the tridentate c-PhP(CH(2)CH(2)S)(2)CH(2)CH(2) ligand. Reaction of 3 with bromine affords seven-coordinate [Mo(CO)(2){c-PhP(CH(2)CH(2)S)(2)CH(2)CH(2)}Br(2)] (7), the X-ray crystal structure of which reveals a carbonyl-capped octahedral geometry. Treatment of 3 with sulfur results in loss of the Mo(CO)(3) fragment and isolation of c-PhPS(CH(2)CH(2)S)(2)CH(2)CH(2) (8), the X-ray structure of which shows a nine-membered ring with the phosphorus center bearing phenyl and sulfide substituents. Reduction of 8 with sodium naphthalenide affords the parent ligand c-PhP(CH(2)CH(2)S)(2)CH(2)CH(2). Crystal data: 2, C(20)H(26)MoP(2)S(4), triclinic P&onemacr;, a = 8.105(3) Å, b = 8.263(3) Å, c = 17.663(4) Å, alpha = 100.29(2) degrees, beta = 99.78(2) degrees, gamma = 98.81(2) degrees, Z = 2; 3, C(15)H(17)MoO(3)PS(2), monoclinic P2(1)/n, a = 9.600(3) Å, b = 15.594(5) Å, c = 11.335(3) Å, beta = 93.01(2) degrees, Z = 4; 7, C(14)H(17)Br(2)MoO(2)PS(2), monoclinic P2(1)/c, a = 17.039(3) Å, b = 8.686(2) Å, c = 12.466(3) Å, beta = 100.52(2) degrees, Z = 4; 8, C(12)H(17)PS(3), monoclinic P2(1), a = 6.651(4) Å, b = 7.313(2) Å, c = 14.687(9) Å, beta = 101.62(3) degrees, Z = 2.