Vanadium Hydrotris(pyrazolyl)borate Complexes of Diphenyl Phosphate. Heterometallic Complexes of the [LV{(PhO)(2)PO(2)}(3)](-) Fragment.

The synthesis and characterization of nine trinuclear, mixed metal complexes of the type [LV{&mgr;-(PhO)(2)PO(2)}(3)](2)M, where the vanadium is in the 3+ oxidation state, L = hydrotris(pyrazolyl)borate, and M = Ba(II) (1), Ca(II) (2), Mg(II) (3), Mn(II) (4), Co(II) (5), Ni(II) (6), Fe(II) (7), 2 Na(I) (8), Al(III) (9), and La(III) (10), are described. X-ray crystal structural analysis of 1, 3, and 4 gave the following parameters: 1, C(92)H(84)B(2)N(12)O(24)P(6)Cl(4)BaV(2), C2/c, a = 26.730(5) Å, b = 15.521(3) Å, c = 27.648(6) Å, beta = 100.53(3) degrees, Z = 4; 3, C(94)H(80)B(2)N(14)O(24)P(6)MgV(2), P&onemacr;, a = 13.410(3) Å, b = 14.179(3) Å, c = 15.694(3) Å, alpha = 112.22(3) degrees, beta = 101.31(3) degrees, gamma = 106.15(3) degrees, Z = 1; 4, C(111)H(80)B(2)N(12)O(28)P(6)MnV(2), R&thremacr;c, a = 18.670(3) Å, b = 18.671(3) Å, c = 61.114(12) Å, Z = 6. Magnetic measurements indicate that compounds containing an integral spin central ion display moderate antiferromagnetic coupling while those with half-integral spins give more complex behavior.