Syntheses and structural characterization of the (OCnOPor) capped porphyrins: Co(OC2OPor).CH2Cl2, Co(OC2OPor)(NO)out.0.46CHCl3, Co(OC3OPor).CHCl3, and Co(OC3OPor)(MeIm).3C7H8.

The compounds Co(OC2OPor).CH2Cl2 (1), Co(OC2OPor)(NO)out.0.46CHCl3 (2), Co(OC3OPor).CHCl3 (3), and Co(OC3OPor)(MeIm).3C7H8 (4) (OC2OPor = 5,10,15,20-(benzene-1,2,4,5- tetrakis(2-phenyloxy)ethoxy)-2',2",2"',2""-tetraylporphyrinato dianion; OC3OPor = 5,10,15,20-(benzene-1,2,4,5-tetrakis(2- phenyloxy)propoxy)-2',2",2"',2""-tetraylporphyrinato dianion; MeIm = 1-methylimidazole), have been synthesized, and their structures have been determined by single-crystal X-ray diffraction methods at T = -120 degrees C: 1, a = 8.824(1) A, b = 16.674(1) A, c = 16.836(1) A, alpha = 104.453(1) degrees, beta = 92.752(1) degrees, gamma = 90.983(1) degrees, P1, Z = 2; 2, a = 9.019(1) A, b = 16.588(2) A, c = 16.909(2) A, alpha = 103.923(2) degrees, beta = 92.082(2) degrees, gamma = 93.583(2) degrees, P1, Z = 2; 3, a = 13.484(3) A, b = 14.404(3) A, c = 14.570(3) A, alpha = 105.508(3) degrees, beta = 100.678(3) degrees, gamma = 93.509(4) degrees, P1, Z = 2; 4, a = 16.490(1) A, b = 22.324(2) A, c = 17.257(1) A, b = 92.437(1) degrees, P2(1)/n, Z = 4. These compounds are the first structurally characterized Co-bound members of the OCnOPor ligand system. The NO ligand in 2 and the MeIm ligand in 4 bind asymmetrically and lead to several metrical changes in these porphyrins, e.g., variations in average porphyrin deviations and Co atom displacements relative to the porphyrinato N atoms and the mean porphyrin planes.